C24H31ClN2O6 — CID 58492300
1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]-3-ethylurea (PubChem CID 58492300) has the molecular formula C24H31ClN2O6 and a molecular weight of 478.97 g/mol. Its IUPAC name is 1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]-3-ethylurea.
| Compound Name | 1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]-3-ethylurea |
|---|---|
| PubChem CID | 58492300 |
| Molecular Formula | C24H31ClN2O6 |
| Molecular Weight | 478.97 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]-3-ethylurea |
| SMILES | CCNC(=O)NC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(OCC)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H31ClN2O6/c1-3-26-24(31)27-13-19-20(28)21(29)22(30)23(33-19)15-7-10-18(25)16(12-15)11-14-5-8-17(9-6-14)32-4-2/h5-10,12,19-23,28-30H,3-4,11,13H2,1-2H3,(H2,26,27,31)/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | CURWZKQYBDKEAD-ZQGJOIPISA-N |
| XLogP | 2.17 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.97 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |