C29H31ClO7S — CID 45110100
2-[4-[[(2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]phenyl]acetic acid (PubChem CID 45110100) has the molecular formula C29H31ClO7S and a molecular weight of 559.08 g/mol. Its IUPAC name is 2-[4-[[(2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[(2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 45110100 |
| Molecular Formula | C29H31ClO7S |
| Molecular Weight | 559.08 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 2-[4-[[(2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]phenyl]acetic acid |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CSc4ccc(CC(=O)O)cc4)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C29H31ClO7S/c1-2-36-21-8-3-17(4-9-21)13-20-15-19(7-12-23(20)30)29-28(35)27(34)26(33)24(37-29)16-38-22-10-5-18(6-11-22)14-25(31)32/h3-12,15,24,26-29,33-35H,2,13-14,16H2,1H3,(H,31,32)/t24-,26-,27+,28-,29+/m1/s1 |
| InChIKey | REWSHGMWZVSLTE-RIAYOEEMSA-N |
| XLogP | 4.27 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.08 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |