C28H30ClNO6S — CID 58436570
3-[[(2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]benzamide (PubChem CID 58436570) has the molecular formula C28H30ClNO6S and a molecular weight of 544.07 g/mol. Its IUPAC name is 3-[[(2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]benzamide.
| Compound Name | 3-[[(2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 58436570 |
| Molecular Formula | C28H30ClNO6S |
| Molecular Weight | 544.07 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 3-[[(2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]benzamide |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CSc4cccc(C(N)=O)c4)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C28H30ClNO6S/c1-2-35-20-9-6-16(7-10-20)12-19-13-17(8-11-22(19)29)27-26(33)25(32)24(31)23(36-27)15-37-21-5-3-4-18(14-21)28(30)34/h3-11,13-14,23-27,31-33H,2,12,15H2,1H3,(H2,30,34)/t23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | PEWDZTPRZCVJIL-SEFGFODJSA-N |
| XLogP | 3.74 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.07 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |