C29H31ClFNO6S — CID 67295562
N-[3-[[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]-4-fluorophenyl]acetamide (PubChem CID 67295562) has the molecular formula C29H31ClFNO6S and a molecular weight of 576.09 g/mol. Its IUPAC name is N-[3-[[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]-4-fluorophenyl]acetamide.
| Compound Name | N-[3-[[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]-4-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 67295562 |
| Molecular Formula | C29H31ClFNO6S |
| Molecular Weight | 576.09 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | N-[3-[[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]-4-fluorophenyl]acetamide |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CSc4cc(NC(C)=O)ccc4F)[C@H](O)[C@@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C29H31ClFNO6S/c1-3-37-21-8-4-17(5-9-21)12-19-13-18(6-10-22(19)30)29-28(36)27(35)26(34)24(38-29)15-39-25-14-20(32-16(2)33)7-11-23(25)31/h4-11,13-14,24,26-29,34-36H,3,12,15H2,1-2H3,(H,32,33)/t24-,26+,27-,28-,29+/m1/s1 |
| InChIKey | NIGPHFZNGGCCPF-AHHSGJDGSA-N |
| XLogP | 4.74 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.09 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |