C30H34ClNO6S — CID 67295748
2-[[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]-N,N-dimethylbenzamide (PubChem CID 67295748) has the molecular formula C30H34ClNO6S and a molecular weight of 572.12 g/mol. Its IUPAC name is 2-[[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]-N,N-dimethylbenzamide.
| Compound Name | 2-[[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 67295748 |
| Molecular Formula | C30H34ClNO6S |
| Molecular Weight | 572.12 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 2-[[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]-N,N-dimethylbenzamide |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CSc4ccccc4C(=O)N(C)C)[C@H](O)[C@@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C30H34ClNO6S/c1-4-37-21-12-9-18(10-13-21)15-20-16-19(11-14-23(20)31)29-28(35)27(34)26(33)24(38-29)17-39-25-8-6-5-7-22(25)30(36)32(2)3/h5-14,16,24,26-29,33-35H,4,15,17H2,1-3H3/t24-,26+,27-,28-,29+/m1/s1 |
| InChIKey | GKHGQHFVRMZEQV-AHHSGJDGSA-N |
| XLogP | 4.35 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.12 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |