C23H28ClNO6 — CID 66885398
N-[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]-N-methylacetamide (PubChem CID 66885398) has the molecular formula C23H28ClNO6 and a molecular weight of 449.93 g/mol. Its IUPAC name is N-[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]-N-methylacetamide.
| Compound Name | N-[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 66885398 |
| Molecular Formula | C23H28ClNO6 |
| Molecular Weight | 449.93 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]-N-methylacetamide |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](N(C)C(C)=O)[C@H](O)[C@@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H28ClNO6/c1-4-30-17-8-5-14(6-9-17)11-16-12-15(7-10-18(16)24)22-20(28)19(27)21(29)23(31-22)25(3)13(2)26/h5-10,12,19-23,27-29H,4,11H2,1-3H3/t19-,20+,21+,22-,23-/m0/s1 |
| InChIKey | XRMYVWALZHWJGA-NQQQLTFYSA-N |
| XLogP | 2.29 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.93 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |