C25H31ClO5S — CID 66885069
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-cyclopentylsulfanyloxane-3,4,5-triol (PubChem CID 66885069) has the molecular formula C25H31ClO5S and a molecular weight of 479.04 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-cyclopentylsulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-cyclopentylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 66885069 |
| Molecular Formula | C25H31ClO5S |
| Molecular Weight | 479.04 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-cyclopentylsulfanyloxane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](SC4CCCC4)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C25H31ClO5S/c1-2-30-18-10-7-15(8-11-18)13-17-14-16(9-12-20(17)26)24-22(28)21(27)23(29)25(31-24)32-19-5-3-4-6-19/h7-12,14,19,21-25,27-29H,2-6,13H2,1H3/t21-,22-,23+,24+,25-/m1/s1 |
| InChIKey | SOFRSPIGCKSIJS-WJGLBBAVSA-N |
| XLogP | 4.49 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.04 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |