C21H24ClNO6 — CID 58587523
(2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxane-2-carboxamide (PubChem CID 58587523) has the molecular formula C21H24ClNO6 and a molecular weight of 421.88 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxane-2-carboxamide |
|---|---|
| PubChem CID | 58587523 |
| Molecular Formula | C21H24ClNO6 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxane-2-carboxamide |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](C(N)=O)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H24ClNO6/c1-2-28-14-6-3-11(4-7-14)9-13-10-12(5-8-15(13)22)19-17(25)16(24)18(26)20(29-19)21(23)27/h3-8,10,16-20,24-26H,2,9H2,1H3,(H2,23,27)/t16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | JIXHGSLFTOKPON-SLHNCBLASA-N |
| XLogP | 1.34 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |