C26H31ClN2O7 — CID 66986205
(2S)-1-[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxane-2-carbonyl]pyrrolidine-2-carboxamide (PubChem CID 66986205) has the molecular formula C26H31ClN2O7 and a molecular weight of 518.99 g/mol. Its IUPAC name is (2S)-1-[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxane-2-carbonyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxane-2-carbonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 66986205 |
| Molecular Formula | C26H31ClN2O7 |
| Molecular Weight | 518.99 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | (2S)-1-[(2S,3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxane-2-carbonyl]pyrrolidine-2-carboxamide |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](C(=O)N4CCC[C@H]4C(N)=O)[C@H](O)[C@@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C26H31ClN2O7/c1-2-35-17-8-5-14(6-9-17)12-16-13-15(7-10-18(16)27)23-21(31)20(30)22(32)24(36-23)26(34)29-11-3-4-19(29)25(28)33/h5-10,13,19-24,30-32H,2-4,11-12H2,1H3,(H2,28,33)/t19-,20-,21+,22+,23-,24-/m0/s1 |
| InChIKey | JMCRZYQCPYAFBL-PQZIIDKGSA-N |
| XLogP | 1.33 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.99 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |