C26H34ClNO6 — CID 143959146
(2S,3R,4R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]oxane-3,4,5-triol (PubChem CID 143959146) has the molecular formula C26H34ClNO6 and a molecular weight of 492.01 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 143959146 |
| Molecular Formula | C26H34ClNO6 |
| Molecular Weight | 492.01 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | (2S,3R,4R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]oxane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3OC(CN4CCC[C@H]4CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C26H34ClNO6/c1-2-33-20-8-5-16(6-9-20)12-18-13-17(7-10-21(18)27)26-25(32)24(31)23(30)22(34-26)14-28-11-3-4-19(28)15-29/h5-10,13,19,22-26,29-32H,2-4,11-12,14-15H2,1H3/t19-,22?,23+,24-,25+,26-/m0/s1 |
| InChIKey | ZELQMNJTTSYMED-RFEILVCYSA-N |
| XLogP | 2.31 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.01 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |