C30H39ClN2O6 — CID 45111846
[(2S)-1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]pyrrolidin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 45111846) has the molecular formula C30H39ClN2O6 and a molecular weight of 559.10 g/mol. Its IUPAC name is [(2S)-1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]pyrrolidin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(2S)-1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]pyrrolidin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 45111846 |
| Molecular Formula | C30H39ClN2O6 |
| Molecular Weight | 559.10 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | [(2S)-1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]pyrrolidin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CN4CCC[C@H]4C(=O)N4CCCC4)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C30H39ClN2O6/c1-2-38-22-10-7-19(8-11-22)16-21-17-20(9-12-23(21)31)29-28(36)27(35)26(34)25(39-29)18-33-15-5-6-24(33)30(37)32-13-3-4-14-32/h7-12,17,24-29,34-36H,2-6,13-16,18H2,1H3/t24-,25+,26+,27-,28+,29-/m0/s1 |
| InChIKey | YZWUAXBACLOVRT-ZSOBKVTGSA-N |
| XLogP | 2.94 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.10 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |