C26H33ClN2O7 — CID 163447915
(2S)-1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 163447915) has the molecular formula C26H33ClN2O7 and a molecular weight of 521.01 g/mol. Its IUPAC name is (2S)-1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163447915 |
| Molecular Formula | C26H33ClN2O7 |
| Molecular Weight | 521.01 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | (2S)-1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CN4CC(O)C[C@H]4C(N)=O)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C26H33ClN2O7/c1-2-35-18-6-3-14(4-7-18)9-16-10-15(5-8-19(16)27)25-24(33)23(32)22(31)21(36-25)13-29-12-17(30)11-20(29)26(28)34/h3-8,10,17,20-25,30-33H,2,9,11-13H2,1H3,(H2,28,34)/t17?,20-,21+,22+,23-,24+,25-/m0/s1 |
| InChIKey | BEBPKGPOYYWNLQ-OOOPVMALSA-N |
| XLogP | 0.77 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.01 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |