C28H35Cl2NO8 — CID 164575415
(2S)-1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]pyrrolidine-2-carboxylic acid;hydrochloride (PubChem CID 164575415) has the molecular formula C28H35Cl2NO8 and a molecular weight of 584.49 g/mol. Its IUPAC name is (2S)-1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]pyrrolidine-2-carboxylic acid;hydrochloride.
| Compound Name | (2S)-1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 164575415 |
| Molecular Formula | C28H35Cl2NO8 |
| Molecular Weight | 584.49 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | (2S)-1-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@@H]1CCCN1C[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(O[C@H]4CCOC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H34ClNO8.ClH/c29-21-8-5-17(13-18(21)12-16-3-6-19(7-4-16)37-20-9-11-36-15-20)27-26(33)25(32)24(31)23(38-27)14-30-10-1-2-22(30)28(34)35;/h3-8,13,20,22-27,31-33H,1-2,9-12,14-15H2,(H,34,35);1H/t20-,22-,23+,24+,25-,26+,27-;/m0./s1 |
| InChIKey | ZMJBITSHWAJAFN-LTUDJFQRSA-N |
| XLogP | 2.59 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |