C29H37ClO9 — CID 155346414
[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-(oxolan-3-yloxy)phenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl 2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 155346414) has the molecular formula C29H37ClO9 and a molecular weight of 565.06 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-(oxolan-3-yloxy)phenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl 2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-(oxolan-3-yloxy)phenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl 2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 155346414 |
| Molecular Formula | C29H37ClO9 |
| Molecular Weight | 565.06 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-(oxolan-3-yloxy)phenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl 2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | CC(C)(C)OCC(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(OC4CCOC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H37ClO9/c1-29(2,3)37-16-24(31)36-15-23-25(32)26(33)27(34)28(39-23)18-6-9-22(30)19(13-18)12-17-4-7-20(8-5-17)38-21-10-11-35-14-21/h4-9,13,21,23,25-28,32-34H,10-12,14-16H2,1-3H3/t21?,23-,25-,26+,27-,28+/m1/s1 |
| InChIKey | MJRPIPBYCSXEKO-RVQXGYOMSA-N |
| XLogP | 2.98 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.06 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |