C34H45ClN2O8 — CID 155346410
[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl 4-piperidin-1-ylpiperidine-1-carboxylate (PubChem CID 155346410) has the molecular formula C34H45ClN2O8 and a molecular weight of 645.19 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl 4-piperidin-1-ylpiperidine-1-carboxylate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl 4-piperidin-1-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 155346410 |
| Molecular Formula | C34H45ClN2O8 |
| Molecular Weight | 645.19 g/mol |
| Exact Mass | 644.29 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl 4-piperidin-1-ylpiperidine-1-carboxylate |
| SMILES | O=C(OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(O[C@@H]4CCOC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C34H45ClN2O8/c35-28-9-6-23(19-24(28)18-22-4-7-26(8-5-22)44-27-12-17-42-20-27)33-32(40)31(39)30(38)29(45-33)21-43-34(41)37-15-10-25(11-16-37)36-13-2-1-3-14-36/h4-9,19,25,27,29-33,38-40H,1-3,10-18,20-21H2/t27-,29-,30-,31+,32-,33+/m1/s1 |
| InChIKey | KYKTYTBNWXRAOK-ANCVDJAISA-N |
| XLogP | 3.71 |
| TPSA | 121.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |