C26H33Cl2NO8 — CID 164575413
(2S)-2-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylamino]propanoic acid;hydrochloride (PubChem CID 164575413) has the molecular formula C26H33Cl2NO8 and a molecular weight of 558.46 g/mol. Its IUPAC name is (2S)-2-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylamino]propanoic acid;hydrochloride.
| Compound Name | (2S)-2-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 164575413 |
| Molecular Formula | C26H33Cl2NO8 |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | (2S)-2-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylamino]propanoic acid;hydrochloride |
| SMILES | C[C@H](NC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(O[C@H]4CCOC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O)C(=O)O.Cl |
| InChI | InChI=1S/C26H32ClNO8.ClH/c1-14(26(32)33)28-12-21-22(29)23(30)24(31)25(36-21)16-4-7-20(27)17(11-16)10-15-2-5-18(6-3-15)35-19-8-9-34-13-19;/h2-7,11,14,19,21-25,28-31H,8-10,12-13H2,1H3,(H,32,33);1H/t14-,19-,21+,22+,23-,24+,25-;/m0./s1 |
| InChIKey | LCNMOURTXKBDOJ-PWHVVSSSSA-N |
| XLogP | 2.11 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |