C32H36ClNO8 — CID 155346407
[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl (2S)-2-amino-3-phenylpropanoate (PubChem CID 155346407) has the molecular formula C32H36ClNO8 and a molecular weight of 598.09 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl (2S)-2-amino-3-phenylpropanoate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 155346407 |
| Molecular Formula | C32H36ClNO8 |
| Molecular Weight | 598.09 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-[4-chloro-3-[[4-[(3R)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl (2S)-2-amino-3-phenylpropanoate |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(O[C@@H]4CCOC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C32H36ClNO8/c33-25-11-8-21(16-22(25)14-20-6-9-23(10-7-20)41-24-12-13-39-17-24)31-30(37)29(36)28(35)27(42-31)18-40-32(38)26(34)15-19-4-2-1-3-5-19/h1-11,16,24,26-31,35-37H,12-15,17-18,34H2/t24-,26+,27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | JFLJKSZNCKPJFX-DLONGVAASA-N |
| XLogP | 2.73 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.09 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |