C25H29ClO8 — CID 169433012
[(2S,3S,4R,5R,6R)-2-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] acetate (PubChem CID 169433012) has the molecular formula C25H29ClO8 and a molecular weight of 492.95 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-2-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] acetate.
| Compound Name | [(2S,3S,4R,5R,6R)-2-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 169433012 |
| Molecular Formula | C25H29ClO8 |
| Molecular Weight | 492.95 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-2-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@H](c2ccc(Cl)c(Cc3ccc(O[C@H]4CCOC4)cc3)c2)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C25H29ClO8/c1-14(28)32-25-22(29)21(12-27)34-24(23(25)30)16-4-7-20(26)17(11-16)10-15-2-5-18(6-3-15)33-19-8-9-31-13-19/h2-7,11,19,21-25,27,29-30H,8-10,12-13H2,1H3/t19-,21+,22+,23-,24-,25-/m0/s1 |
| InChIKey | REPYAUDMTWGFLL-FCBBFLBBSA-N |
| XLogP | 2.18 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.95 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |