C32H35ClFNO6S — CID 67388930
[3-[[(2S,3R,4S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]-4-fluorophenyl]-pyrrolidin-1-ylmethanone (PubChem CID 67388930) has the molecular formula C32H35ClFNO6S and a molecular weight of 616.15 g/mol. Its IUPAC name is [3-[[(2S,3R,4S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]-4-fluorophenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-[[(2S,3R,4S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]-4-fluorophenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 67388930 |
| Molecular Formula | C32H35ClFNO6S |
| Molecular Weight | 616.15 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | [3-[[(2S,3R,4S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]-4-fluorophenyl]-pyrrolidin-1-ylmethanone |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CSc4cc(C(=O)N5CCCC5)ccc4F)[C@H](O)[C@@H](O)C3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C32H35ClFNO6S/c1-2-40-23-9-5-19(6-10-23)15-22-16-20(7-11-24(22)33)31-30(38)29(37)28(36)26(41-31)18-42-27-17-21(8-12-25(27)34)32(39)35-13-3-4-14-35/h5-12,16-17,26,28-31,36-38H,2-4,13-15,18H2,1H3/t26-,28+,29-,30?,31+/m1/s1 |
| InChIKey | NWRJMIRWTMMLCF-YIKQDBPZSA-N |
| XLogP | 5.02 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.15 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |