C32H36ClNO6S — CID 123631486
2-[2-[[(2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]phenyl]pyrrolidine-1-carbaldehyde (PubChem CID 123631486) has the molecular formula C32H36ClNO6S and a molecular weight of 598.16 g/mol. Its IUPAC name is 2-[2-[[(2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]phenyl]pyrrolidine-1-carbaldehyde.
| Compound Name | 2-[2-[[(2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]phenyl]pyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 123631486 |
| Molecular Formula | C32H36ClNO6S |
| Molecular Weight | 598.16 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | 2-[2-[[(2S,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methylsulfanyl]phenyl]pyrrolidine-1-carbaldehyde |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CSc4ccccc4C4CCCN4C=O)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C32H36ClNO6S/c1-2-39-23-12-9-20(10-13-23)16-22-17-21(11-14-25(22)33)32-31(38)30(37)29(36)27(40-32)18-41-28-8-4-3-6-24(28)26-7-5-15-34(26)19-35/h3-4,6,8-14,17,19,26-27,29-32,36-38H,2,5,7,15-16,18H2,1H3/t26?,27-,29-,30+,31-,32+/m1/s1 |
| InChIKey | HLIUNLFPCPMMRB-HPBAPQCZSA-N |
| XLogP | 4.94 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.16 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|