C27H35ClO6 — CID 66584142
(3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(1-ethylcyclopentyl)methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 66584142) has the molecular formula C27H35ClO6 and a molecular weight of 491.02 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(1-ethylcyclopentyl)methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(1-ethylcyclopentyl)methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 66584142 |
| Molecular Formula | C27H35ClO6 |
| Molecular Weight | 491.02 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | (3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(1-ethylcyclopentyl)methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCC1(COc2ccc(Cc3cc(C4O[C@H](CO)[C@@H](O)[C@H](O)C4O)ccc3Cl)cc2)CCCC1 |
| InChI | InChI=1S/C27H35ClO6/c1-2-27(11-3-4-12-27)16-33-20-8-5-17(6-9-20)13-19-14-18(7-10-21(19)28)26-25(32)24(31)23(30)22(15-29)34-26/h5-10,14,22-26,29-32H,2-4,11-13,15-16H2,1H3/t22-,23-,24+,25?,26?/m1/s1 |
| InChIKey | CNMIBWITBAZJCP-SXKBUZGKSA-N |
| XLogP | 3.79 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.02 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |