C29H31ClO7 — CID 118461908
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[[(2S)-2-methyl-3H-1-benzofuran-2-yl]methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 118461908) has the molecular formula C29H31ClO7 and a molecular weight of 527.01 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[[(2S)-2-methyl-3H-1-benzofuran-2-yl]methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[[(2S)-2-methyl-3H-1-benzofuran-2-yl]methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 118461908 |
| Molecular Formula | C29H31ClO7 |
| Molecular Weight | 527.01 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[[(2S)-2-methyl-3H-1-benzofuran-2-yl]methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C[C@@]1(COc2ccc(Cc3cc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)ccc3Cl)cc2)Cc2ccccc2O1 |
| InChI | InChI=1S/C29H31ClO7/c1-29(14-19-4-2-3-5-23(19)37-29)16-35-21-9-6-17(7-10-21)12-20-13-18(8-11-22(20)30)28-27(34)26(33)25(32)24(15-31)36-28/h2-11,13,24-28,31-34H,12,14-16H2,1H3/t24-,25-,26+,27-,28+,29+/m1/s1 |
| InChIKey | ICPXVOYHMMUINK-GLAVCGJZSA-N |
| XLogP | 3.22 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.01 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |