C31H36O7 — CID 118461955
(2S,3R,4R,5S,6R)-2-[3-[[4-[(2,5-dimethyl-3H-1-benzofuran-2-yl)methoxy]phenyl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 118461955) has the molecular formula C31H36O7 and a molecular weight of 520.62 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[[4-[(2,5-dimethyl-3H-1-benzofuran-2-yl)methoxy]phenyl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[[4-[(2,5-dimethyl-3H-1-benzofuran-2-yl)methoxy]phenyl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 118461955 |
| Molecular Formula | C31H36O7 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[[4-[(2,5-dimethyl-3H-1-benzofuran-2-yl)methoxy]phenyl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1ccc2c(c1)CC(C)(COc1ccc(Cc3cc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)ccc3C)cc1)O2 |
| InChI | InChI=1S/C31H36O7/c1-18-4-11-25-23(12-18)15-31(3,38-25)17-36-24-9-6-20(7-10-24)13-22-14-21(8-5-19(22)2)30-29(35)28(34)27(33)26(16-32)37-30/h4-12,14,26-30,32-35H,13,15-17H2,1-3H3/t26-,27-,28+,29-,30+,31?/m1/s1 |
| InChIKey | BIRBDCCZGGUOPM-WWMRYPBGSA-N |
| XLogP | 3.18 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |