C24H26ClF3O6 — CID 66583023
(3R,4R,5S,6R)-2-[4-chloro-3-[[4-[[1-(trifluoromethyl)cyclopropyl]methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 66583023) has the molecular formula C24H26ClF3O6 and a molecular weight of 502.91 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2-[4-chloro-3-[[4-[[1-(trifluoromethyl)cyclopropyl]methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-2-[4-chloro-3-[[4-[[1-(trifluoromethyl)cyclopropyl]methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 66583023 |
| Molecular Formula | C24H26ClF3O6 |
| Molecular Weight | 502.91 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | (3R,4R,5S,6R)-2-[4-chloro-3-[[4-[[1-(trifluoromethyl)cyclopropyl]methoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1OC(c2ccc(Cl)c(Cc3ccc(OCC4(C(F)(F)F)CC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H26ClF3O6/c25-17-6-3-14(22-21(32)20(31)19(30)18(11-29)34-22)10-15(17)9-13-1-4-16(5-2-13)33-12-23(7-8-23)24(26,27)28/h1-6,10,18-22,29-32H,7-9,11-12H2/t18-,19-,20+,21-,22?/m1/s1 |
| InChIKey | LAGPAPSQEVHXSW-VEIQOZLZSA-N |
| XLogP | 3.17 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.91 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |