C25H31ClO7 — CID 71206755
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(1R,2S)-2-methoxycyclopentyl]oxyphenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71206755) has the molecular formula C25H31ClO7 and a molecular weight of 478.97 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(1R,2S)-2-methoxycyclopentyl]oxyphenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(1R,2S)-2-methoxycyclopentyl]oxyphenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71206755 |
| Molecular Formula | C25H31ClO7 |
| Molecular Weight | 478.97 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(1R,2S)-2-methoxycyclopentyl]oxyphenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CO[C@H]1CCC[C@H]1Oc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C25H31ClO7/c1-31-19-3-2-4-20(19)32-17-8-5-14(6-9-17)11-16-12-15(7-10-18(16)26)25-24(30)23(29)22(28)21(13-27)33-25/h5-10,12,19-25,27-30H,2-4,11,13H2,1H3/t19-,20+,21+,22+,23-,24+,25-/m0/s1 |
| InChIKey | PQEXLFRMHUWIOE-PCCAQPIBSA-N |
| XLogP | 2.39 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.97 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |