C23H26ClNO7 — CID 143726191
3-[4-[[2-chloro-5-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]pyrrolidin-2-one (PubChem CID 143726191) has the molecular formula C23H26ClNO7 and a molecular weight of 463.91 g/mol. Its IUPAC name is 3-[4-[[2-chloro-5-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]pyrrolidin-2-one.
| Compound Name | 3-[4-[[2-chloro-5-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]pyrrolidin-2-one |
|---|---|
| PubChem CID | 143726191 |
| Molecular Formula | C23H26ClNO7 |
| Molecular Weight | 463.91 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 3-[4-[[2-chloro-5-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]pyrrolidin-2-one |
| SMILES | O=C1NCCC1Oc1ccc(Cc2cc([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H26ClNO7/c24-16-6-3-13(22-21(29)20(28)19(27)18(11-26)32-22)10-14(16)9-12-1-4-15(5-2-12)31-17-7-8-25-23(17)30/h1-6,10,17-22,26-29H,7-9,11H2,(H,25,30)/t17?,18?,19-,20+,21?,22+/m1/s1 |
| InChIKey | SSCDTBFBWQRKQT-YCUVTSRXSA-N |
| XLogP | 0.71 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.91 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |