C22H23ClN2O7 — CID 53468416
3-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]imidazolidine-2,4-dione (PubChem CID 53468416) has the molecular formula C22H23ClN2O7 and a molecular weight of 462.89 g/mol. Its IUPAC name is 3-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 53468416 |
| Molecular Formula | C22H23ClN2O7 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 3-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1c1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H23ClN2O7/c23-15-6-3-12(21-20(30)19(29)18(28)16(10-26)32-21)8-13(15)7-11-1-4-14(5-2-11)25-17(27)9-24-22(25)31/h1-6,8,16,18-21,26,28-30H,7,9-10H2,(H,24,31)/t16-,18-,19+,20-,21+/m1/s1 |
| InChIKey | NUFBHJSIYQSEEZ-RQXATKFSSA-N |
| XLogP | 0.50 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|