C25H26ClNO6 — CID 70857322
5-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]-1-methylpyridin-2-one (PubChem CID 70857322) has the molecular formula C25H26ClNO6 and a molecular weight of 471.94 g/mol. Its IUPAC name is 5-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]-1-methylpyridin-2-one.
| Compound Name | 5-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 70857322 |
| Molecular Formula | C25H26ClNO6 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 5-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(-c2ccc(Cc3cc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)ccc3Cl)cc2)ccc1=O |
| InChI | InChI=1S/C25H26ClNO6/c1-27-12-17(7-9-21(27)29)15-4-2-14(3-5-15)10-18-11-16(6-8-19(18)26)25-24(32)23(31)22(30)20(13-28)33-25/h2-9,11-12,20,22-25,28,30-32H,10,13H2,1H3/t20-,22-,23+,24-,25+/m1/s1 |
| InChIKey | KGHGXIVYOLYMPV-HFBCXCLPSA-N |
| XLogP | 1.81 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |