C28H39ClN2O7 — CID 59557779
(2R,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59557779) has the molecular formula C28H39ClN2O7 and a molecular weight of 551.08 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59557779 |
| Molecular Formula | C28H39ClN2O7 |
| Molecular Weight | 551.08 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CN1CCN(CCOCCOc2ccc(Cc3cc([C@H]4O[C@H](CO)[C@@H](O)[C@H](O)C4O)ccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C28H39ClN2O7/c1-30-8-10-31(11-9-30)12-13-36-14-15-37-22-5-2-19(3-6-22)16-21-17-20(4-7-23(21)29)28-27(35)26(34)25(33)24(18-32)38-28/h2-7,17,24-28,32-35H,8-16,18H2,1H3/t24-,25-,26+,27?,28-/m1/s1 |
| InChIKey | XGACZVLFWVPGNK-VLNFOUIWSA-N |
| XLogP | 1.09 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.08 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|