C28H39ClN2O5 — CID 143768214
2-[4-chloro-3-[[4-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 143768214) has the molecular formula C28H39ClN2O5 and a molecular weight of 519.08 g/mol. Its IUPAC name is 2-[4-chloro-3-[[4-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[4-chloro-3-[[4-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 143768214 |
| Molecular Formula | C28H39ClN2O5 |
| Molecular Weight | 519.08 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 2-[4-chloro-3-[[4-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | CN1CCN(CCOCCOc2ccc(Cc3cc(C4CC(O)CC(CO)O4)ccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C28H39ClN2O5/c1-30-8-10-31(11-9-30)12-13-34-14-15-35-25-5-2-21(3-6-25)16-23-17-22(4-7-27(23)29)28-19-24(33)18-26(20-32)36-28/h2-7,17,24,26,28,32-33H,8-16,18-20H2,1H3 |
| InChIKey | WVUJPZSSQVMFMQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.08 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|