C22H29ClO5 — CID 144726733
(2R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;methanol (PubChem CID 144726733) has the molecular formula C22H29ClO5 and a molecular weight of 408.92 g/mol. Its IUPAC name is (2R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;methanol.
| Compound Name | (2R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;methanol |
|---|---|
| PubChem CID | 144726733 |
| Molecular Formula | C22H29ClO5 |
| Molecular Weight | 408.92 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (2R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;methanol |
| SMILES | CCOc1ccc(Cc2cc([C@H]3CC(O)CC(CO)O3)ccc2Cl)cc1.CO |
| InChI | InChI=1S/C21H25ClO4.CH4O/c1-2-25-18-6-3-14(4-7-18)9-16-10-15(5-8-20(16)22)21-12-17(24)11-19(13-23)26-21;1-2/h3-8,10,17,19,21,23-24H,2,9,11-13H2,1H3;2H,1H3/t17?,19?,21-;/m1./s1 |
| InChIKey | KILPEIPIKWVOLB-LQNKJABGSA-N |
| XLogP | 3.51 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.92 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |