C23H27ClO3 — CID 145480632
acetylene;(2R,4S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methyloxan-4-ol (PubChem CID 145480632) has the molecular formula C23H27ClO3 and a molecular weight of 386.92 g/mol. Its IUPAC name is acetylene;(2R,4S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methyloxan-4-ol.
| Compound Name | acetylene;(2R,4S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methyloxan-4-ol |
|---|---|
| PubChem CID | 145480632 |
| Molecular Formula | C23H27ClO3 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | acetylene;(2R,4S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methyloxan-4-ol |
| SMILES | C#C.CCOc1ccc(Cc2cc([C@H]3C[C@@H](O)C[C@@H](C)O3)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H25ClO3.C2H2/c1-3-24-19-7-4-15(5-8-19)11-17-12-16(6-9-20(17)22)21-13-18(23)10-14(2)25-21;1-2/h4-9,12,14,18,21,23H,3,10-11,13H2,1-2H3;1-2H/t14-,18+,21-;/m1./s1 |
| InChIKey | PUDVUSQAKUJCSA-RDSDLCAFSA-N |
| XLogP | 5.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|