C22H27ClO5 — CID 126735493
(2S,3R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-ethoxyoxane-3,5-diol (PubChem CID 126735493) has the molecular formula C22H27ClO5 and a molecular weight of 406.91 g/mol. Its IUPAC name is (2S,3R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-ethoxyoxane-3,5-diol.
| Compound Name | (2S,3R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-ethoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 126735493 |
| Molecular Formula | C22H27ClO5 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (2S,3R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-ethoxyoxane-3,5-diol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3OC(OCC)[C@@H](O)C[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H27ClO5/c1-3-26-17-8-5-14(6-9-17)11-16-12-15(7-10-18(16)23)21-19(24)13-20(25)22(28-21)27-4-2/h5-10,12,19-22,24-25H,3-4,11,13H2,1-2H3/t19-,20+,21+,22?/m1/s1 |
| InChIKey | CYDPXOAIFQIXQU-ZPHWTRHBSA-N |
| XLogP | 3.88 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |