C22H25ClO5 — CID 52914480
(5S,6R,7R,8S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-oxaspiro[2.5]octane-6,7,8-triol (PubChem CID 52914480) has the molecular formula C22H25ClO5 and a molecular weight of 404.89 g/mol. Its IUPAC name is (5S,6R,7R,8S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-oxaspiro[2.5]octane-6,7,8-triol.
| Compound Name | (5S,6R,7R,8S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-oxaspiro[2.5]octane-6,7,8-triol |
|---|---|
| PubChem CID | 52914480 |
| Molecular Formula | C22H25ClO5 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (5S,6R,7R,8S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-oxaspiro[2.5]octane-6,7,8-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3OC4(CC4)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H25ClO5/c1-2-27-16-6-3-13(4-7-16)11-15-12-14(5-8-17(15)23)20-18(24)19(25)21(26)22(28-20)9-10-22/h3-8,12,18-21,24-26H,2,9-11H2,1H3/t18-,19-,20+,21+/m1/s1 |
| InChIKey | YHTPQSKJTLTDAN-CGXNFDGLSA-N |
| XLogP | 3.02 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |