C26H33ClO7 — CID 72709455
(2S,3R,4R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-10-methyl-1,8,12-trioxaspiro[5.7]tridecane-3,4,5-triol (PubChem CID 72709455) has the molecular formula C26H33ClO7 and a molecular weight of 493.00 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-10-methyl-1,8,12-trioxaspiro[5.7]tridecane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-10-methyl-1,8,12-trioxaspiro[5.7]tridecane-3,4,5-triol |
|---|---|
| PubChem CID | 72709455 |
| Molecular Formula | C26H33ClO7 |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | (2S,3R,4R,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-10-methyl-1,8,12-trioxaspiro[5.7]tridecane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3OC4(COCC(C)COC4)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C26H33ClO7/c1-3-33-20-7-4-17(5-8-20)10-19-11-18(6-9-21(19)27)24-22(28)23(29)25(30)26(34-24)14-31-12-16(2)13-32-15-26/h4-9,11,16,22-25,28-30H,3,10,12-15H2,1-2H3/t16?,22-,23-,24+,25+,26?/m1/s1 |
| InChIKey | HOWLIKAXXUZBCW-KNLIRQEBSA-N |
| XLogP | 2.91 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |