C24H31ClO4 — CID 118457954
2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3-ethyl-5-methoxy-6-methyloxan-4-ol (PubChem CID 118457954) has the molecular formula C24H31ClO4 and a molecular weight of 418.96 g/mol. Its IUPAC name is 2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3-ethyl-5-methoxy-6-methyloxan-4-ol.
| Compound Name | 2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3-ethyl-5-methoxy-6-methyloxan-4-ol |
|---|---|
| PubChem CID | 118457954 |
| Molecular Formula | C24H31ClO4 |
| Molecular Weight | 418.96 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3-ethyl-5-methoxy-6-methyloxan-4-ol |
| SMILES | CCOc1ccc(Cc2cc(C3OC(C)C(OC)C(O)C3CC)ccc2Cl)cc1 |
| InChI | InChI=1S/C24H31ClO4/c1-5-20-22(26)23(27-4)15(3)29-24(20)17-9-12-21(25)18(14-17)13-16-7-10-19(11-8-16)28-6-2/h7-12,14-15,20,22-24,26H,5-6,13H2,1-4H3 |
| InChIKey | ILLANHQCAFKQLW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.96 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |