C23H27ClO7 — CID 67074694
(5S,6R,7R,8S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-(dihydroxymethyl)-4-oxaspiro[2.5]octane-6,7,8-triol (PubChem CID 67074694) has the molecular formula C23H27ClO7 and a molecular weight of 450.92 g/mol. Its IUPAC name is (5S,6R,7R,8S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-(dihydroxymethyl)-4-oxaspiro[2.5]octane-6,7,8-triol.
| Compound Name | (5S,6R,7R,8S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-(dihydroxymethyl)-4-oxaspiro[2.5]octane-6,7,8-triol |
|---|---|
| PubChem CID | 67074694 |
| Molecular Formula | C23H27ClO7 |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (5S,6R,7R,8S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-(dihydroxymethyl)-4-oxaspiro[2.5]octane-6,7,8-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3OC4(CC4C(O)O)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H27ClO7/c1-2-30-15-6-3-12(4-7-15)9-14-10-13(5-8-17(14)24)20-18(25)19(26)21(27)23(31-20)11-16(23)22(28)29/h3-8,10,16,18-22,25-29H,2,9,11H2,1H3/t16?,18-,19-,20+,21+,23?/m1/s1 |
| InChIKey | ZOYNMJCFTFNROT-STNNZUEUSA-N |
| XLogP | 1.55 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|