C24H27ClO5 — CID 149308621
(4S,5R,6R,9S,10R)-9-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-8-oxadispiro[2.1.25.33]decane-4,6,10-triol (PubChem CID 149308621) has the molecular formula C24H27ClO5 and a molecular weight of 430.93 g/mol. Its IUPAC name is (4S,5R,6R,9S,10R)-9-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-8-oxadispiro[2.1.25.33]decane-4,6,10-triol.
| Compound Name | (4S,5R,6R,9S,10R)-9-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-8-oxadispiro[2.1.25.33]decane-4,6,10-triol |
|---|---|
| PubChem CID | 149308621 |
| Molecular Formula | C24H27ClO5 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (4S,5R,6R,9S,10R)-9-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-8-oxadispiro[2.1.25.33]decane-4,6,10-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@@]4(C[C@H]4O)[C@@H](O)C4(CC4)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C24H27ClO5/c1-2-29-17-6-3-14(4-7-17)11-16-12-15(5-8-18(16)25)20-21(27)23(9-10-23)22(28)24(30-20)13-19(24)26/h3-8,12,19-22,26-28H,2,9-11,13H2,1H3/t19-,20+,21+,22+,24-/m1/s1 |
| InChIKey | XYECZFBHELFLOH-XALOWKIYSA-N |
| XLogP | 3.41 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |