C23H31ClO4 — CID 143981727
2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;ethane (PubChem CID 143981727) has the molecular formula C23H31ClO4 and a molecular weight of 406.95 g/mol. Its IUPAC name is 2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;ethane.
| Compound Name | 2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;ethane |
|---|---|
| PubChem CID | 143981727 |
| Molecular Formula | C23H31ClO4 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol;ethane |
| SMILES | CC.CCOc1ccc(Cc2cc(C3CC(O)CC(CO)O3)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H25ClO4.C2H6/c1-2-25-18-6-3-14(4-7-18)9-16-10-15(5-8-20(16)22)21-12-17(24)11-19(13-23)26-21;1-2/h3-8,10,17,19,21,23-24H,2,9,11-13H2,1H3;1-2H3 |
| InChIKey | AVZRFAJMZBWRNV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |