C21H23ClO6 — CID 143928485
[4-[[2-chloro-5-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] methyl carbonate (PubChem CID 143928485) has the molecular formula C21H23ClO6 and a molecular weight of 406.86 g/mol. Its IUPAC name is [4-[[2-chloro-5-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] methyl carbonate.
| Compound Name | [4-[[2-chloro-5-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] methyl carbonate |
|---|---|
| PubChem CID | 143928485 |
| Molecular Formula | C21H23ClO6 |
| Molecular Weight | 406.86 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [4-[[2-chloro-5-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc(Cc2cc(C3CC(O)CC(CO)O3)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H23ClO6/c1-26-21(25)28-17-5-2-13(3-6-17)8-15-9-14(4-7-19(15)22)20-11-16(24)10-18(12-23)27-20/h2-7,9,16,18,20,23-24H,8,10-12H2,1H3 |
| InChIKey | LCCQZSHQQVPTMG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.86 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|