C25H29ClO4 — CID 134485104
2-[4-chloro-3-[[4-[(E)-3-cyclopropylprop-2-enoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 134485104) has the molecular formula C25H29ClO4 and a molecular weight of 428.96 g/mol. Its IUPAC name is 2-[4-chloro-3-[[4-[(E)-3-cyclopropylprop-2-enoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[4-chloro-3-[[4-[(E)-3-cyclopropylprop-2-enoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 134485104 |
| Molecular Formula | C25H29ClO4 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-[4-chloro-3-[[4-[(E)-3-cyclopropylprop-2-enoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | OCC1CC(O)CC(c2ccc(Cl)c(Cc3ccc(OC/C=C/C4CC4)cc3)c2)O1 |
| InChI | InChI=1S/C25H29ClO4/c26-24-10-7-19(25-15-21(28)14-23(16-27)30-25)13-20(24)12-18-5-8-22(9-6-18)29-11-1-2-17-3-4-17/h1-2,5-10,13,17,21,23,25,27-28H,3-4,11-12,14-16H2/b2-1+ |
| InChIKey | WFPAXTAZFCSONW-OWOJBTEDSA-N |
| XLogP | 4.85 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|