C25H35ClO3 — CID 143959113
2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-propyloxan-4-ol;ethane (PubChem CID 143959113) has the molecular formula C25H35ClO3 and a molecular weight of 419.01 g/mol. Its IUPAC name is 2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-propyloxan-4-ol;ethane.
| Compound Name | 2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-propyloxan-4-ol;ethane |
|---|---|
| PubChem CID | 143959113 |
| Molecular Formula | C25H35ClO3 |
| Molecular Weight | 419.01 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-propyloxan-4-ol;ethane |
| SMILES | CC.CCCC1CC(O)CC(c2ccc(Cl)c(Cc3ccc(OCC)cc3)c2)O1 |
| InChI | InChI=1S/C23H29ClO3.C2H6/c1-3-5-21-14-19(25)15-23(27-21)17-8-11-22(24)18(13-17)12-16-6-9-20(10-7-16)26-4-2;1-2/h6-11,13,19,21,23,25H,3-5,12,14-15H2,1-2H3;1-2H3 |
| InChIKey | LUBVQEQIWIFACC-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.01 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |