C23H31NO3 — CID 90984963
2-[4-amino-3-[(4-ethoxyphenyl)methyl]phenyl]-6-propyloxan-4-ol (PubChem CID 90984963) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-[4-amino-3-[(4-ethoxyphenyl)methyl]phenyl]-6-propyloxan-4-ol.
| Compound Name | 2-[4-amino-3-[(4-ethoxyphenyl)methyl]phenyl]-6-propyloxan-4-ol |
|---|---|
| PubChem CID | 90984963 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 2-[4-amino-3-[(4-ethoxyphenyl)methyl]phenyl]-6-propyloxan-4-ol |
| SMILES | CCCC1CC(O)CC(c2ccc(N)c(Cc3ccc(OCC)cc3)c2)O1 |
| InChI | InChI=1S/C23H31NO3/c1-3-5-21-14-19(25)15-23(27-21)17-8-11-22(24)18(13-17)12-16-6-9-20(10-7-16)26-4-2/h6-11,13,19,21,23,25H,3-5,12,14-15,24H2,1-2H3 |
| InChIKey | BWJTUXKLYSUHLD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|