C21H25BrO4 — CID 123569394
2-[4-bromo-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 123569394) has the molecular formula C21H25BrO4 and a molecular weight of 421.33 g/mol. Its IUPAC name is 2-[4-bromo-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[4-bromo-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 123569394 |
| Molecular Formula | C21H25BrO4 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 2-[4-bromo-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | CCOc1ccc(Cc2cc(C3CC(O)CC(CO)O3)ccc2Br)cc1 |
| InChI | InChI=1S/C21H25BrO4/c1-2-25-18-6-3-14(4-7-18)9-16-10-15(5-8-20(16)22)21-12-17(24)11-19(13-23)26-21/h3-8,10,17,19,21,23-24H,2,9,11-13H2,1H3 |
| InChIKey | KYOFOWSNRVQFMT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |