C24H32O6 — CID 145041957
2-[2-ethoxy-5-[(4-ethoxyphenyl)methyl]-4-methoxyphenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 145041957) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-[2-ethoxy-5-[(4-ethoxyphenyl)methyl]-4-methoxyphenyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[2-ethoxy-5-[(4-ethoxyphenyl)methyl]-4-methoxyphenyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 145041957 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 2-[2-ethoxy-5-[(4-ethoxyphenyl)methyl]-4-methoxyphenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | CCOc1ccc(Cc2cc(C3CC(O)CC(CO)O3)c(OCC)cc2OC)cc1 |
| InChI | InChI=1S/C24H32O6/c1-4-28-19-8-6-16(7-9-19)10-17-11-21(23(29-5-2)14-22(17)27-3)24-13-18(26)12-20(15-25)30-24/h6-9,11,14,18,20,24-26H,4-5,10,12-13,15H2,1-3H3 |
| InChIKey | VDRRQYAILISOTA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |