C22H26ClNO5 — CID 129162638
2-[4-chloro-3-[[4-[(2E)-2-methoxyiminoethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 129162638) has the molecular formula C22H26ClNO5 and a molecular weight of 419.91 g/mol. Its IUPAC name is 2-[4-chloro-3-[[4-[(2E)-2-methoxyiminoethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[4-chloro-3-[[4-[(2E)-2-methoxyiminoethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 129162638 |
| Molecular Formula | C22H26ClNO5 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 2-[4-chloro-3-[[4-[(2E)-2-methoxyiminoethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | CO/N=C/COc1ccc(Cc2cc(C3CC(O)CC(CO)O3)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H26ClNO5/c1-27-24-8-9-28-19-5-2-15(3-6-19)10-17-11-16(4-7-21(17)23)22-13-18(26)12-20(14-25)29-22/h2-8,11,18,20,22,25-26H,9-10,12-14H2,1H3/b24-8+ |
| InChIKey | DHZBOFYLHOYAON-KTZMUZOWSA-N |
| XLogP | 3.52 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|