C23H28ClNO4 — CID 131968298
2-[3-[[4-(azetidin-3-ylmethoxy)phenyl]methyl]-4-chlorophenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 131968298) has the molecular formula C23H28ClNO4 and a molecular weight of 417.93 g/mol. Its IUPAC name is 2-[3-[[4-(azetidin-3-ylmethoxy)phenyl]methyl]-4-chlorophenyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[3-[[4-(azetidin-3-ylmethoxy)phenyl]methyl]-4-chlorophenyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 131968298 |
| Molecular Formula | C23H28ClNO4 |
| Molecular Weight | 417.93 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-[3-[[4-(azetidin-3-ylmethoxy)phenyl]methyl]-4-chlorophenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | OCC1CC(O)CC(c2ccc(Cl)c(Cc3ccc(OCC4CNC4)cc3)c2)O1 |
| InChI | InChI=1S/C23H28ClNO4/c24-22-6-3-17(23-10-19(27)9-21(13-26)29-23)8-18(22)7-15-1-4-20(5-2-15)28-14-16-11-25-12-16/h1-6,8,16,19,21,23,25-27H,7,9-14H2 |
| InChIKey | ADGFRJZJWMQTJQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.93 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |