C23H27ClO4 — CID 147438965
(5S,6R,7R,8S)-5-[4-chloro-3-[(4-propylphenyl)methyl]phenyl]-4-oxaspiro[2.5]octane-6,7,8-triol (PubChem CID 147438965) has the molecular formula C23H27ClO4 and a molecular weight of 402.92 g/mol. Its IUPAC name is (5S,6R,7R,8S)-5-[4-chloro-3-[(4-propylphenyl)methyl]phenyl]-4-oxaspiro[2.5]octane-6,7,8-triol.
| Compound Name | (5S,6R,7R,8S)-5-[4-chloro-3-[(4-propylphenyl)methyl]phenyl]-4-oxaspiro[2.5]octane-6,7,8-triol |
|---|---|
| PubChem CID | 147438965 |
| Molecular Formula | C23H27ClO4 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (5S,6R,7R,8S)-5-[4-chloro-3-[(4-propylphenyl)methyl]phenyl]-4-oxaspiro[2.5]octane-6,7,8-triol |
| SMILES | CCCc1ccc(Cc2cc([C@@H]3OC4(CC4)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H27ClO4/c1-2-3-14-4-6-15(7-5-14)12-17-13-16(8-9-18(17)24)21-19(25)20(26)22(27)23(28-21)10-11-23/h4-9,13,19-22,25-27H,2-3,10-12H2,1H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | DVVMFCPIRBPILU-CZYKHXBRSA-N |
| XLogP | 3.57 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |