C23H29ClO2 — CID 134484877
3-[4-chloro-3-[(4-propylphenyl)methyl]phenyl]-5-(hydroxymethyl)cyclohexan-1-ol (PubChem CID 134484877) has the molecular formula C23H29ClO2 and a molecular weight of 372.94 g/mol. Its IUPAC name is 3-[4-chloro-3-[(4-propylphenyl)methyl]phenyl]-5-(hydroxymethyl)cyclohexan-1-ol.
| Compound Name | 3-[4-chloro-3-[(4-propylphenyl)methyl]phenyl]-5-(hydroxymethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 134484877 |
| Molecular Formula | C23H29ClO2 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 3-[4-chloro-3-[(4-propylphenyl)methyl]phenyl]-5-(hydroxymethyl)cyclohexan-1-ol |
| SMILES | CCCc1ccc(Cc2cc(C3CC(O)CC(CO)C3)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H29ClO2/c1-2-3-16-4-6-17(7-5-16)10-21-13-19(8-9-23(21)24)20-11-18(15-25)12-22(26)14-20/h4-9,13,18,20,22,25-26H,2-3,10-12,14-15H2,1H3 |
| InChIKey | PBESMAUHBMLCKH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |