C22H27ClO4 — CID 45107747
(1S,2R,3R,4R,6S)-6-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-4-deuterio-4-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 45107747) has the molecular formula C22H27ClO4 and a molecular weight of 391.91 g/mol. Its IUPAC name is (1S,2R,3R,4R,6S)-6-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-4-deuterio-4-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1S,2R,3R,4R,6S)-6-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-4-deuterio-4-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 45107747 |
| Molecular Formula | C22H27ClO4 |
| Molecular Weight | 391.91 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (1S,2R,3R,4R,6S)-6-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-4-deuterio-4-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | [2H][C@]1(CO)C[C@@H](c2ccc(Cl)c(Cc3ccc(CC)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H27ClO4/c1-2-13-3-5-14(6-4-13)9-16-10-15(7-8-19(16)23)18-11-17(12-24)20(25)22(27)21(18)26/h3-8,10,17-18,20-22,24-27H,2,9,11-12H2,1H3/t17-,18+,20-,21+,22+/m1/s1/i17D |
| InChIKey | VLSZCJOYIOQMPQ-NECCCUDCSA-N |
| XLogP | 2.67 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.91 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |